C21H24N2O2 — CID 129359194
(1R,2S)-2-N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-1-N-cyclopropylcyclohex-4-ene-1,2-dicarboxamide (PubChem CID 129359194) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is (1R,2S)-2-N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-1-N-cyclopropylcyclohex-4-ene-1,2-dicarboxamide.
| Compound Name | (1R,2S)-2-N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-1-N-cyclopropylcyclohex-4-ene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 129359194 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | (1R,2S)-2-N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-1-N-cyclopropylcyclohex-4-ene-1,2-dicarboxamide |
| SMILES | O=C(N[C@@H]1[C@@H]2Cc3ccccc3[C@H]21)[C@H]1CC=CC[C@H]1C(=O)NC1CC1 |
| InChI | InChI=1S/C21H24N2O2/c24-20(22-13-9-10-13)15-7-3-4-8-16(15)21(25)23-19-17-11-12-5-1-2-6-14(12)18(17)19/h1-6,13,15-19H,7-11H2,(H,22,24)(H,23,25)/t15-,16+,17-,18-,19-/m1/s1 |
| InChIKey | MJVWJJRRNMWVNU-RHQZKXFESA-N |
| XLogP | 2.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|