C17H11F4NO — CID 98556741
N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,3,5,6-tetrafluorobenzamide (PubChem CID 98556741) has the molecular formula C17H11F4NO and a molecular weight of 321.27 g/mol. Its IUPAC name is N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,3,5,6-tetrafluorobenzamide.
| Compound Name | N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,3,5,6-tetrafluorobenzamide |
|---|---|
| PubChem CID | 98556741 |
| Molecular Formula | C17H11F4NO |
| Molecular Weight | 321.27 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-[(1R,1aS,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2,3,5,6-tetrafluorobenzamide |
| SMILES | O=C(N[C@@H]1[C@@H]2Cc3ccccc3[C@H]21)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C17H11F4NO/c18-10-6-11(19)15(21)13(14(10)20)17(23)22-16-9-5-7-3-1-2-4-8(7)12(9)16/h1-4,6,9,12,16H,5H2,(H,22,23)/t9-,12-,16-/m1/s1 |
| InChIKey | DOOASQRWQMIIOF-VYROHLMNSA-N |
| XLogP | 3.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|