C17H14Cl2N2O — CID 124744341
N-[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-3-amino-2,4-dichlorobenzamide (PubChem CID 124744341) has the molecular formula C17H14Cl2N2O and a molecular weight of 333.22 g/mol. Its IUPAC name is N-[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-3-amino-2,4-dichlorobenzamide.
| Compound Name | N-[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-3-amino-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 124744341 |
| Molecular Formula | C17H14Cl2N2O |
| Molecular Weight | 333.22 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | N-[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-3-amino-2,4-dichlorobenzamide |
| SMILES | Nc1c(Cl)ccc(C(=O)N[C@@H]2[C@@H]3Cc4ccccc4[C@@H]32)c1Cl |
| InChI | InChI=1S/C17H14Cl2N2O/c18-12-6-5-10(14(19)15(12)20)17(22)21-16-11-7-8-3-1-2-4-9(8)13(11)16/h1-6,11,13,16H,7,20H2,(H,21,22)/t11-,13+,16-/m1/s1 |
| InChIKey | ZXDFZPHHRDLTNM-PVXIVEMSSA-N |
| XLogP | 3.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.22 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|