C19H17NO3 — CID 129469957
4-[2-[[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]amino]-2-oxoethyl]benzoic acid (PubChem CID 129469957) has the molecular formula C19H17NO3 and a molecular weight of 307.35 g/mol. Its IUPAC name is 4-[2-[[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]amino]-2-oxoethyl]benzoic acid.
| Compound Name | 4-[2-[[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]amino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 129469957 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 4-[2-[[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]amino]-2-oxoethyl]benzoic acid |
| SMILES | O=C(Cc1ccc(C(=O)O)cc1)N[C@@H]1[C@@H]2Cc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C19H17NO3/c21-16(9-11-5-7-12(8-6-11)19(22)23)20-18-15-10-13-3-1-2-4-14(13)17(15)18/h1-8,15,17-18H,9-10H2,(H,20,21)(H,22,23)/t15-,17+,18-/m1/s1 |
| InChIKey | IATZFFNZEGDTBF-BPQIPLTHSA-N |
| XLogP | 2.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |