C22H24N2O2 — CID 97103340
N-[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2-[acetyl(2-phenylethyl)amino]acetamide (PubChem CID 97103340) has the molecular formula C22H24N2O2 and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2-[acetyl(2-phenylethyl)amino]acetamide.
| Compound Name | N-[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2-[acetyl(2-phenylethyl)amino]acetamide |
|---|---|
| PubChem CID | 97103340 |
| Molecular Formula | C22H24N2O2 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | N-[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-2-[acetyl(2-phenylethyl)amino]acetamide |
| SMILES | CC(=O)N(CCc1ccccc1)CC(=O)N[C@@H]1[C@@H]2Cc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C22H24N2O2/c1-15(25)24(12-11-16-7-3-2-4-8-16)14-20(26)23-22-19-13-17-9-5-6-10-18(17)21(19)22/h2-10,19,21-22H,11-14H2,1H3,(H,23,26)/t19-,21+,22-/m1/s1 |
| InChIKey | ZZWRITWREIDHRD-BAGYTPMASA-N |
| XLogP | 2.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |