C17H22N2O3S — CID 97244295
1-[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-3-[(1,1-dioxothian-4-yl)methyl]urea (PubChem CID 97244295) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-3-[(1,1-dioxothian-4-yl)methyl]urea.
| Compound Name | 1-[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-3-[(1,1-dioxothian-4-yl)methyl]urea |
|---|---|
| PubChem CID | 97244295 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-[(1R,1aR,6aR)-1,1a,6,6a-tetrahydrocyclopropa[a]inden-1-yl]-3-[(1,1-dioxothian-4-yl)methyl]urea |
| SMILES | O=C(NCC1CCS(=O)(=O)CC1)N[C@@H]1[C@@H]2Cc3ccccc3[C@@H]21 |
| InChI | InChI=1S/C17H22N2O3S/c20-17(18-10-11-5-7-23(21,22)8-6-11)19-16-14-9-12-3-1-2-4-13(12)15(14)16/h1-4,11,14-16H,5-10H2,(H2,18,19,20)/t14-,15+,16-/m1/s1 |
| InChIKey | RDHFVHCRAAGVLT-OWCLPIDISA-N |
| XLogP | 1.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |