C16H19BrIN3S — CID 120666001
1-[(1R,2S)-2-(2-bromophenyl)cyclopropyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 120666001) has the molecular formula C16H19BrIN3S and a molecular weight of 492.22 g/mol. Its IUPAC name is 1-[(1R,2S)-2-(2-bromophenyl)cyclopropyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[(1R,2S)-2-(2-bromophenyl)cyclopropyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 120666001 |
| Molecular Formula | C16H19BrIN3S |
| Molecular Weight | 492.22 g/mol |
| Exact Mass | 490.95 |
| IUPAC Name | 1-[(1R,2S)-2-(2-bromophenyl)cyclopropyl]-2-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCc1cccs1)N[C@@H]1C[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C16H18BrN3S.HI/c17-14-6-2-1-5-12(14)13-10-15(13)20-16(18)19-8-7-11-4-3-9-21-11;/h1-6,9,13,15H,7-8,10H2,(H3,18,19,20);1H/t13-,15+;/m0./s1 |
| InChIKey | JXUWJMDUXFAMSW-NQQJLSKUSA-N |
| XLogP | 4.13 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.22 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|