C16H18FN3S — CID 120606094
1-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]-2-(2-thiophen-2-ylethyl)guanidine (PubChem CID 120606094) has the molecular formula C16H18FN3S and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]-2-(2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]-2-(2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 120606094 |
| Molecular Formula | C16H18FN3S |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 1-[(1R,2S)-2-(4-fluorophenyl)cyclopropyl]-2-(2-thiophen-2-ylethyl)guanidine |
| SMILES | N/C(=N\CCc1cccs1)N[C@@H]1C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FN3S/c17-12-5-3-11(4-6-12)14-10-15(14)20-16(18)19-8-7-13-2-1-9-21-13/h1-6,9,14-15H,7-8,10H2,(H3,18,19,20)/t14-,15+/m0/s1 |
| InChIKey | AFWJVIYKGAWWIR-LSDHHAIUSA-N |
| XLogP | 2.89 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|