C7H17N5 — CID 170129585
1-[(1S,3S)-3-hydrazinylcyclopentyl]-2-methylguanidine (PubChem CID 170129585) has the molecular formula C7H17N5 and a molecular weight of 171.25 g/mol. Its IUPAC name is 1-[(1S,3S)-3-hydrazinylcyclopentyl]-2-methylguanidine.
| Compound Name | 1-[(1S,3S)-3-hydrazinylcyclopentyl]-2-methylguanidine |
|---|---|
| PubChem CID | 170129585 |
| Molecular Formula | C7H17N5 |
| Molecular Weight | 171.25 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | 1-[(1S,3S)-3-hydrazinylcyclopentyl]-2-methylguanidine |
| SMILES | C/N=C(\N)N[C@H]1CC[C@H](NN)C1 |
| InChI | InChI=1S/C7H17N5/c1-10-7(8)11-5-2-3-6(4-5)12-9/h5-6,12H,2-4,9H2,1H3,(H3,8,10,11)/t5-,6-/m0/s1 |
| InChIKey | JNBFPNKJUPNXND-WDSKDSINSA-N |
| XLogP | -1.10 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.25 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|