C14H29N5O2 — CID 170129986
tert-butyl N-methyl-N-[methyl-[(1S,3S)-3-[(N'-methylcarbamimidoyl)amino]cyclopentyl]amino]carbamate (PubChem CID 170129986) has the molecular formula C14H29N5O2 and a molecular weight of 299.42 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[methyl-[(1S,3S)-3-[(N'-methylcarbamimidoyl)amino]cyclopentyl]amino]carbamate.
| Compound Name | tert-butyl N-methyl-N-[methyl-[(1S,3S)-3-[(N'-methylcarbamimidoyl)amino]cyclopentyl]amino]carbamate |
|---|---|
| PubChem CID | 170129986 |
| Molecular Formula | C14H29N5O2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.23 |
| IUPAC Name | tert-butyl N-methyl-N-[methyl-[(1S,3S)-3-[(N'-methylcarbamimidoyl)amino]cyclopentyl]amino]carbamate |
| SMILES | C/N=C(\N)N[C@H]1CC[C@H](N(C)N(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C14H29N5O2/c1-14(2,3)21-13(20)19(6)18(5)11-8-7-10(9-11)17-12(15)16-4/h10-11H,7-9H2,1-6H3,(H3,15,16,17)/t10-,11-/m0/s1 |
| InChIKey | ADWGZTKLNDTSNW-QWRGUYRKSA-N |
| XLogP | 1.16 |
| TPSA | 83.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|