C13H27N5O2 — CID 170130568
tert-butyl N-methyl-N-[[(1S,3S)-3-[(N'-methylcarbamimidoyl)amino]cyclopentyl]amino]carbamate (PubChem CID 170130568) has the molecular formula C13H27N5O2 and a molecular weight of 285.39 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[[(1S,3S)-3-[(N'-methylcarbamimidoyl)amino]cyclopentyl]amino]carbamate.
| Compound Name | tert-butyl N-methyl-N-[[(1S,3S)-3-[(N'-methylcarbamimidoyl)amino]cyclopentyl]amino]carbamate |
|---|---|
| PubChem CID | 170130568 |
| Molecular Formula | C13H27N5O2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | tert-butyl N-methyl-N-[[(1S,3S)-3-[(N'-methylcarbamimidoyl)amino]cyclopentyl]amino]carbamate |
| SMILES | C/N=C(\N)N[C@H]1CC[C@H](NN(C)C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C13H27N5O2/c1-13(2,3)20-12(19)18(5)17-10-7-6-9(8-10)16-11(14)15-4/h9-10,17H,6-8H2,1-5H3,(H3,14,15,16)/t9-,10-/m0/s1 |
| InChIKey | CHUJXIMVAHLDJZ-UWVGGRQHSA-N |
| XLogP | 0.81 |
| TPSA | 91.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|