C16H27N5O8 — CID 58864144
2-[[2-[bis(carboxymethyl)amino]-4-[(N'-methylcarbamimidoyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid (PubChem CID 58864144) has the molecular formula C16H27N5O8 and a molecular weight of 417.42 g/mol. Its IUPAC name is 2-[[2-[bis(carboxymethyl)amino]-4-[(N'-methylcarbamimidoyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[2-[bis(carboxymethyl)amino]-4-[(N'-methylcarbamimidoyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 58864144 |
| Molecular Formula | C16H27N5O8 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | 2-[[2-[bis(carboxymethyl)amino]-4-[(N'-methylcarbamimidoyl)amino]cyclohexyl]-(carboxymethyl)amino]acetic acid |
| SMILES | C/N=C(\N)NC1CCC(N(CC(=O)O)CC(=O)O)C(N(CC(=O)O)CC(=O)O)C1 |
| InChI | InChI=1S/C16H27N5O8/c1-18-16(17)19-9-2-3-10(20(5-12(22)23)6-13(24)25)11(4-9)21(7-14(26)27)8-15(28)29/h9-11H,2-8H2,1H3,(H,22,23)(H,24,25)(H,26,27)(H,28,29)(H3,17,18,19) |
| InChIKey | LIJFCPAISLNKNV-UHFFFAOYSA-N |
| XLogP | -2.25 |
| TPSA | 206.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|