C19H23ClN2O3 — CID 120668297
methyl 3-[4-[[2-amino-2-(4-methylphenyl)acetyl]amino]phenyl]propanoate;hydrochloride (PubChem CID 120668297) has the molecular formula C19H23ClN2O3 and a molecular weight of 362.86 g/mol. Its IUPAC name is methyl 3-[4-[[2-amino-2-(4-methylphenyl)acetyl]amino]phenyl]propanoate;hydrochloride.
| Compound Name | methyl 3-[4-[[2-amino-2-(4-methylphenyl)acetyl]amino]phenyl]propanoate;hydrochloride |
|---|---|
| PubChem CID | 120668297 |
| Molecular Formula | C19H23ClN2O3 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | methyl 3-[4-[[2-amino-2-(4-methylphenyl)acetyl]amino]phenyl]propanoate;hydrochloride |
| SMILES | COC(=O)CCc1ccc(NC(=O)C(N)c2ccc(C)cc2)cc1.Cl |
| InChI | InChI=1S/C19H22N2O3.ClH/c1-13-3-8-15(9-4-13)18(20)19(23)21-16-10-5-14(6-11-16)7-12-17(22)24-2;/h3-6,8-11,18H,7,12,20H2,1-2H3,(H,21,23);1H |
| InChIKey | BWYUBWJROOHDKF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |