C22H13NO3 — CID 12067049
12-acetyl-13-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1,4,6,8,11,14,16,18,20-nonaene-3,10-dione (PubChem CID 12067049) has the molecular formula C22H13NO3 and a molecular weight of 339.35 g/mol. Its IUPAC name is 12-acetyl-13-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1,4,6,8,11,14,16,18,20-nonaene-3,10-dione.
| Compound Name | 12-acetyl-13-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1,4,6,8,11,14,16,18,20-nonaene-3,10-dione |
|---|---|
| PubChem CID | 12067049 |
| Molecular Formula | C22H13NO3 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 12-acetyl-13-azapentacyclo[11.8.0.02,11.04,9.014,19]henicosa-1,4,6,8,11,14,16,18,20-nonaene-3,10-dione |
| SMILES | CC(=O)c1c2c(c3ccc4ccccc4n13)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C22H13NO3/c1-12(24)20-19-18(21(25)14-7-3-4-8-15(14)22(19)26)17-11-10-13-6-2-5-9-16(13)23(17)20/h2-11H,1H3 |
| InChIKey | GFYFFICLUYRDKF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|