C13H17ClIN3 — CID 120671121
N-[(1R,2S)-2-(4-chlorophenyl)cyclopropyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide (PubChem CID 120671121) has the molecular formula C13H17ClIN3 and a molecular weight of 377.66 g/mol. Its IUPAC name is N-[(1R,2S)-2-(4-chlorophenyl)cyclopropyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide.
| Compound Name | N-[(1R,2S)-2-(4-chlorophenyl)cyclopropyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
|---|---|
| PubChem CID | 120671121 |
| Molecular Formula | C13H17ClIN3 |
| Molecular Weight | 377.66 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | N-[(1R,2S)-2-(4-chlorophenyl)cyclopropyl]-1,4,5,6-tetrahydropyrimidin-2-amine;hydroiodide |
| SMILES | Clc1ccc([C@@H]2C[C@H]2NC2=NCCCN2)cc1.I |
| InChI | InChI=1S/C13H16ClN3.HI/c14-10-4-2-9(3-5-10)11-8-12(11)17-13-15-6-1-7-16-13;/h2-5,11-12H,1,6-8H2,(H2,15,16,17);1H/t11-,12+;/m0./s1 |
| InChIKey | DHIHOSZJNCSWAQ-ZVWHLABXSA-N |
| XLogP | 2.75 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.66 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|