C17H19F2N3O — CID 120671777
1-[3-(3,5-difluorophenyl)cyclobutyl]-3-(furan-2-ylmethyl)-2-methylguanidine (PubChem CID 120671777) has the molecular formula C17H19F2N3O and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-[3-(3,5-difluorophenyl)cyclobutyl]-3-(furan-2-ylmethyl)-2-methylguanidine.
| Compound Name | 1-[3-(3,5-difluorophenyl)cyclobutyl]-3-(furan-2-ylmethyl)-2-methylguanidine |
|---|---|
| PubChem CID | 120671777 |
| Molecular Formula | C17H19F2N3O |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 1-[3-(3,5-difluorophenyl)cyclobutyl]-3-(furan-2-ylmethyl)-2-methylguanidine |
| SMILES | C/N=C(\NCc1ccco1)NC1CC(c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C17H19F2N3O/c1-20-17(21-10-16-3-2-4-23-16)22-15-7-12(8-15)11-5-13(18)9-14(19)6-11/h2-6,9,12,15H,7-8,10H2,1H3,(H2,20,21,22) |
| InChIKey | ZZYIVYMKOWAZGK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|