C18H21NO3 — CID 120674180
4-(1-phenylbut-3-ynylcarbamoyl)cyclohexane-1-carboxylic acid (PubChem CID 120674180) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 4-(1-phenylbut-3-ynylcarbamoyl)cyclohexane-1-carboxylic acid.
| Compound Name | 4-(1-phenylbut-3-ynylcarbamoyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120674180 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-(1-phenylbut-3-ynylcarbamoyl)cyclohexane-1-carboxylic acid |
| SMILES | C#CCC(NC(=O)C1CCC(C(=O)O)CC1)c1ccccc1 |
| InChI | InChI=1S/C18H21NO3/c1-2-6-16(13-7-4-3-5-8-13)19-17(20)14-9-11-15(12-10-14)18(21)22/h1,3-5,7-8,14-16H,6,9-12H2,(H,19,20)(H,21,22) |
| InChIKey | GAQKXQCJYZPYBM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|