C14H16N2O — CID 75390293
1-(1-phenylbut-3-ynyl)-3-prop-2-enylurea (PubChem CID 75390293) has the molecular formula C14H16N2O and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-(1-phenylbut-3-ynyl)-3-prop-2-enylurea.
| Compound Name | 1-(1-phenylbut-3-ynyl)-3-prop-2-enylurea |
|---|---|
| PubChem CID | 75390293 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 1-(1-phenylbut-3-ynyl)-3-prop-2-enylurea |
| SMILES | C#CCC(NC(=O)NCC=C)c1ccccc1 |
| InChI | InChI=1S/C14H16N2O/c1-3-8-13(12-9-6-5-7-10-12)16-14(17)15-11-4-2/h1,4-7,9-10,13H,2,8,11H2,(H2,15,16,17) |
| InChIKey | IPKBEQJYBMERMO-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|