C18H31ClN2O5S — CID 120680517
(3aS,6aR)-2-[2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride (PubChem CID 120680517) has the molecular formula C18H31ClN2O5S and a molecular weight of 422.98 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride.
| Compound Name | (3aS,6aR)-2-[2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 120680517 |
| Molecular Formula | C18H31ClN2O5S |
| Molecular Weight | 422.98 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | (3aS,6aR)-2-[2-[butyl-(1,1-dioxothiolan-3-yl)amino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid;hydrochloride |
| SMILES | CCCCN(C(=O)CN1C[C@@H]2CCC[C@@]2(C(=O)O)C1)C1CCS(=O)(=O)C1.Cl |
| InChI | InChI=1S/C18H30N2O5S.ClH/c1-2-3-8-20(15-6-9-26(24,25)12-15)16(21)11-19-10-14-5-4-7-18(14,13-19)17(22)23;/h14-15H,2-13H2,1H3,(H,22,23);1H/t14-,15?,18+;/m0./s1 |
| InChIKey | RADKXONMGIAESF-XSDCBPNDSA-N |
| XLogP | 1.41 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.98 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |