C15H27NO5S2 — CID 71894374
N-butyl-2-cyclopentylsulfonyl-N-(1,1-dioxothiolan-3-yl)acetamide (PubChem CID 71894374) has the molecular formula C15H27NO5S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-butyl-2-cyclopentylsulfonyl-N-(1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | N-butyl-2-cyclopentylsulfonyl-N-(1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 71894374 |
| Molecular Formula | C15H27NO5S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-butyl-2-cyclopentylsulfonyl-N-(1,1-dioxothiolan-3-yl)acetamide |
| SMILES | CCCCN(C(=O)CS(=O)(=O)C1CCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H27NO5S2/c1-2-3-9-16(13-8-10-22(18,19)11-13)15(17)12-23(20,21)14-6-4-5-7-14/h13-14H,2-12H2,1H3 |
| InChIKey | YKLYSXCRJKFXJX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |