C17H19ClN6O3 — CID 120680672
(3aS,6aR)-2-[2-[2-chloro-5-(tetrazol-1-yl)anilino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 120680672) has the molecular formula C17H19ClN6O3 and a molecular weight of 390.83 g/mol. Its IUPAC name is (3aS,6aR)-2-[2-[2-chloro-5-(tetrazol-1-yl)anilino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[2-[2-chloro-5-(tetrazol-1-yl)anilino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 120680672 |
| Molecular Formula | C17H19ClN6O3 |
| Molecular Weight | 390.83 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (3aS,6aR)-2-[2-[2-chloro-5-(tetrazol-1-yl)anilino]-2-oxoethyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | O=C(CN1C[C@@H]2CCC[C@@]2(C(=O)O)C1)Nc1cc(-n2cnnn2)ccc1Cl |
| InChI | InChI=1S/C17H19ClN6O3/c18-13-4-3-12(24-10-19-21-22-24)6-14(13)20-15(25)8-23-7-11-2-1-5-17(11,9-23)16(26)27/h3-4,6,10-11H,1-2,5,7-9H2,(H,20,25)(H,26,27)/t11-,17+/m0/s1 |
| InChIKey | CYCVEZJNMOJPKB-APPDUMDISA-N |
| XLogP | 1.44 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.83 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |