C15H27NO4 — CID 120689194
2-(2,4-dimethylpent-4-enoylamino)-4-[(2-methylpropan-2-yl)oxy]butanoic acid (PubChem CID 120689194) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is 2-(2,4-dimethylpent-4-enoylamino)-4-[(2-methylpropan-2-yl)oxy]butanoic acid.
| Compound Name | 2-(2,4-dimethylpent-4-enoylamino)-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
|---|---|
| PubChem CID | 120689194 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 2-(2,4-dimethylpent-4-enoylamino)-4-[(2-methylpropan-2-yl)oxy]butanoic acid |
| SMILES | C=C(C)CC(C)C(=O)NC(CCOC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C15H27NO4/c1-10(2)9-11(3)13(17)16-12(14(18)19)7-8-20-15(4,5)6/h11-12H,1,7-9H2,2-6H3,(H,16,17)(H,18,19) |
| InChIKey | DYDQEGPCZWYZGX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|