C18H23NO3 — CID 120691709
1-[2-(3-methylcyclohexyl)acetyl]-2,3-dihydroindole-3-carboxylic acid (PubChem CID 120691709) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is 1-[2-(3-methylcyclohexyl)acetyl]-2,3-dihydroindole-3-carboxylic acid.
| Compound Name | 1-[2-(3-methylcyclohexyl)acetyl]-2,3-dihydroindole-3-carboxylic acid |
|---|---|
| PubChem CID | 120691709 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | 1-[2-(3-methylcyclohexyl)acetyl]-2,3-dihydroindole-3-carboxylic acid |
| SMILES | CC1CCCC(CC(=O)N2CC(C(=O)O)c3ccccc32)C1 |
| InChI | InChI=1S/C18H23NO3/c1-12-5-4-6-13(9-12)10-17(20)19-11-15(18(21)22)14-7-2-3-8-16(14)19/h2-3,7-8,12-13,15H,4-6,9-11H2,1H3,(H,21,22) |
| InChIKey | IXJOHTRGQVTGEV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |