C20H24ClN3O3 — CID 120693538
(E)-2-[[1-tert-butyl-3-(2-chlorophenyl)pyrazole-4-carbonyl]amino]hex-4-enoic acid (PubChem CID 120693538) has the molecular formula C20H24ClN3O3 and a molecular weight of 389.88 g/mol. Its IUPAC name is (E)-2-[[1-tert-butyl-3-(2-chlorophenyl)pyrazole-4-carbonyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[1-tert-butyl-3-(2-chlorophenyl)pyrazole-4-carbonyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120693538 |
| Molecular Formula | C20H24ClN3O3 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | (E)-2-[[1-tert-butyl-3-(2-chlorophenyl)pyrazole-4-carbonyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)c1cn(C(C)(C)C)nc1-c1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C20H24ClN3O3/c1-5-6-11-16(19(26)27)22-18(25)14-12-24(20(2,3)4)23-17(14)13-9-7-8-10-15(13)21/h5-10,12,16H,11H2,1-4H3,(H,22,25)(H,26,27)/b6-5+ |
| InChIKey | NYPMDKKDMIKMMA-AATRIKPKSA-N |
| XLogP | 4.11 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|