C18H23ClN2O4 — CID 120694188
(E)-2-[[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]amino]hex-4-enoic acid (PubChem CID 120694188) has the molecular formula C18H23ClN2O4 and a molecular weight of 366.85 g/mol. Its IUPAC name is (E)-2-[[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]amino]hex-4-enoic acid.
| Compound Name | (E)-2-[[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]amino]hex-4-enoic acid |
|---|---|
| PubChem CID | 120694188 |
| Molecular Formula | C18H23ClN2O4 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (E)-2-[[2-[(2-chlorobenzoyl)amino]-3-methylbutanoyl]amino]hex-4-enoic acid |
| SMILES | C/C=C/CC(NC(=O)C(NC(=O)c1ccccc1Cl)C(C)C)C(=O)O |
| InChI | InChI=1S/C18H23ClN2O4/c1-4-5-10-14(18(24)25)20-17(23)15(11(2)3)21-16(22)12-8-6-7-9-13(12)19/h4-9,11,14-15H,10H2,1-3H3,(H,20,23)(H,21,22)(H,24,25)/b5-4+ |
| InChIKey | LMQZRPWSYKDBTC-SNAWJCMRSA-N |
| XLogP | 2.63 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|