C15H24N4O3 — CID 120698743
2-[4-[(3-cyclohexylbutanoylamino)methyl]triazol-1-yl]acetic acid (PubChem CID 120698743) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-[4-[(3-cyclohexylbutanoylamino)methyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[(3-cyclohexylbutanoylamino)methyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 120698743 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 2-[4-[(3-cyclohexylbutanoylamino)methyl]triazol-1-yl]acetic acid |
| SMILES | CC(CC(=O)NCc1cn(CC(=O)O)nn1)C1CCCCC1 |
| InChI | InChI=1S/C15H24N4O3/c1-11(12-5-3-2-4-6-12)7-14(20)16-8-13-9-19(18-17-13)10-15(21)22/h9,11-12H,2-8,10H2,1H3,(H,16,20)(H,21,22) |
| InChIKey | ACXVYYUXGHDGGK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |