C15H18N2O5 — CID 120701997
2-[2-(2-cyanophenoxy)propanoylamino]-4-methoxybutanoic acid (PubChem CID 120701997) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-[2-(2-cyanophenoxy)propanoylamino]-4-methoxybutanoic acid.
| Compound Name | 2-[2-(2-cyanophenoxy)propanoylamino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 120701997 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-[2-(2-cyanophenoxy)propanoylamino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)C(C)Oc1ccccc1C#N)C(=O)O |
| InChI | InChI=1S/C15H18N2O5/c1-10(22-13-6-4-3-5-11(13)9-16)14(18)17-12(15(19)20)7-8-21-2/h3-6,10,12H,7-8H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | SONGYDXWRINOTF-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |