C20H22N2O2 — CID 46525689
2-(2-cyanophenoxy)-N-[1-(4-ethylphenyl)ethyl]propanamide (PubChem CID 46525689) has the molecular formula C20H22N2O2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[1-(4-ethylphenyl)ethyl]propanamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[1-(4-ethylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 46525689 |
| Molecular Formula | C20H22N2O2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[1-(4-ethylphenyl)ethyl]propanamide |
| SMILES | CCc1ccc(C(C)NC(=O)C(C)Oc2ccccc2C#N)cc1 |
| InChI | InChI=1S/C20H22N2O2/c1-4-16-9-11-17(12-10-16)14(2)22-20(23)15(3)24-19-8-6-5-7-18(19)13-21/h5-12,14-15H,4H2,1-3H3,(H,22,23) |
| InChIKey | KJOUUNYWGSOVQC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |