C14H17Cl2NO4S — CID 120702240
2-[2-(2,5-dichlorophenyl)sulfanylpropanoylamino]-4-methoxybutanoic acid (PubChem CID 120702240) has the molecular formula C14H17Cl2NO4S and a molecular weight of 366.27 g/mol. Its IUPAC name is 2-[2-(2,5-dichlorophenyl)sulfanylpropanoylamino]-4-methoxybutanoic acid.
| Compound Name | 2-[2-(2,5-dichlorophenyl)sulfanylpropanoylamino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 120702240 |
| Molecular Formula | C14H17Cl2NO4S |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 2-[2-(2,5-dichlorophenyl)sulfanylpropanoylamino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)C(C)Sc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C14H17Cl2NO4S/c1-8(22-12-7-9(15)3-4-10(12)16)13(18)17-11(14(19)20)5-6-21-2/h3-4,7-8,11H,5-6H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | QUTLTSVXNCFWKW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |