C15H18FNO4 — CID 120702690
2-[[(E)-4-(4-fluorophenyl)but-3-enoyl]amino]-4-methoxybutanoic acid (PubChem CID 120702690) has the molecular formula C15H18FNO4 and a molecular weight of 295.31 g/mol. Its IUPAC name is 2-[[(E)-4-(4-fluorophenyl)but-3-enoyl]amino]-4-methoxybutanoic acid.
| Compound Name | 2-[[(E)-4-(4-fluorophenyl)but-3-enoyl]amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 120702690 |
| Molecular Formula | C15H18FNO4 |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-[[(E)-4-(4-fluorophenyl)but-3-enoyl]amino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)C/C=C/c1ccc(F)cc1)C(=O)O |
| InChI | InChI=1S/C15H18FNO4/c1-21-10-9-13(15(19)20)17-14(18)4-2-3-11-5-7-12(16)8-6-11/h2-3,5-8,13H,4,9-10H2,1H3,(H,17,18)(H,19,20)/b3-2+ |
| InChIKey | IVYDMMUCYULFLW-NSCUHMNNSA-N |
| XLogP | 1.83 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |