C13H16FNO5 — CID 120977642
2-[(5-fluoro-2-methoxybenzoyl)amino]-4-methoxybutanoic acid (PubChem CID 120977642) has the molecular formula C13H16FNO5 and a molecular weight of 285.27 g/mol. Its IUPAC name is 2-[(5-fluoro-2-methoxybenzoyl)amino]-4-methoxybutanoic acid.
| Compound Name | 2-[(5-fluoro-2-methoxybenzoyl)amino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 120977642 |
| Molecular Formula | C13H16FNO5 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[(5-fluoro-2-methoxybenzoyl)amino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)c1cc(F)ccc1OC)C(=O)O |
| InChI | InChI=1S/C13H16FNO5/c1-19-6-5-10(13(17)18)15-12(16)9-7-8(14)3-4-11(9)20-2/h3-4,7,10H,5-6H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | KHAQNMYGNZYRSR-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |