C12H18ClFN2O2S — CID 120708491
[1-(2-fluoro-6-methylphenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride (PubChem CID 120708491) has the molecular formula C12H18ClFN2O2S and a molecular weight of 308.81 g/mol. Its IUPAC name is [1-(2-fluoro-6-methylphenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride.
| Compound Name | [1-(2-fluoro-6-methylphenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride |
|---|---|
| PubChem CID | 120708491 |
| Molecular Formula | C12H18ClFN2O2S |
| Molecular Weight | 308.81 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | [1-(2-fluoro-6-methylphenyl)sulfonylpyrrolidin-3-yl]methanamine;hydrochloride |
| SMILES | Cc1cccc(F)c1S(=O)(=O)N1CCC(CN)C1.Cl |
| InChI | InChI=1S/C12H17FN2O2S.ClH/c1-9-3-2-4-11(13)12(9)18(16,17)15-6-5-10(7-14)8-15;/h2-4,10H,5-8,14H2,1H3;1H |
| InChIKey | SFUIVPVWGVOUSC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.81 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |