C26H42O6 — CID 12070866
(3aR,4R,5R,6aS)-4-[(3R)-3-cyclohexyl-3-(oxan-2-yloxy)propyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 12070866) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is (3aR,4R,5R,6aS)-4-[(3R)-3-cyclohexyl-3-(oxan-2-yloxy)propyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4R,5R,6aS)-4-[(3R)-3-cyclohexyl-3-(oxan-2-yloxy)propyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 12070866 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | (3aR,4R,5R,6aS)-4-[(3R)-3-cyclohexyl-3-(oxan-2-yloxy)propyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | O=C1C[C@@H]2[C@@H](CC[C@@H](OC3CCCCO3)C3CCCCC3)[C@H](OC3CCCCO3)C[C@@H]2O1 |
| InChI | InChI=1S/C26H42O6/c27-24-16-20-19(22(17-23(20)30-24)32-26-11-5-7-15-29-26)12-13-21(18-8-2-1-3-9-18)31-25-10-4-6-14-28-25/h18-23,25-26H,1-17H2/t19-,20-,21-,22-,23+,25?,26?/m1/s1 |
| InChIKey | ZZVUEGZSEXFMPT-AHUKYTTFSA-N |
| XLogP | 5.12 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |