C22H36F2O5 — CID 59958132
(4R)-4-(4,4-difluoro-3-hydroxydecyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 59958132) has the molecular formula C22H36F2O5 and a molecular weight of 418.52 g/mol. Its IUPAC name is (4R)-4-(4,4-difluoro-3-hydroxydecyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (4R)-4-(4,4-difluoro-3-hydroxydecyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 59958132 |
| Molecular Formula | C22H36F2O5 |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | (4R)-4-(4,4-difluoro-3-hydroxydecyl)-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | CCCCCCC(F)(F)C(O)CC[C@H]1C(OC2CCCCO2)CC2OC(=O)CC21 |
| InChI | InChI=1S/C22H36F2O5/c1-2-3-4-6-11-22(23,24)19(25)10-9-15-16-13-20(26)28-18(16)14-17(15)29-21-8-5-7-12-27-21/h15-19,21,25H,2-14H2,1H3/t15-,16?,17?,18?,19?,21?/m1/s1 |
| InChIKey | QQXGATCUWOVRIC-SPZRFILISA-N |
| XLogP | 4.60 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|