C20H32F2O5 — CID 134990764
1-[(3aR,4R,5R,6aS)-2-hydroxy-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-4,4-difluorooctan-3-one (PubChem CID 134990764) has the molecular formula C20H32F2O5 and a molecular weight of 390.47 g/mol. Its IUPAC name is 1-[(3aR,4R,5R,6aS)-2-hydroxy-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-4,4-difluorooctan-3-one.
| Compound Name | 1-[(3aR,4R,5R,6aS)-2-hydroxy-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-4,4-difluorooctan-3-one |
|---|---|
| PubChem CID | 134990764 |
| Molecular Formula | C20H32F2O5 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 1-[(3aR,4R,5R,6aS)-2-hydroxy-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-2H-cyclopenta[b]furan-4-yl]-4,4-difluorooctan-3-one |
| SMILES | CCCCC(F)(F)C(=O)CC[C@@H]1[C@H]2CC(O)O[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C20H32F2O5/c1-2-3-9-20(21,22)17(23)8-7-13-14-11-18(24)26-16(14)12-15(13)27-19-6-4-5-10-25-19/h13-16,18-19,24H,2-12H2,1H3/t13-,14-,15-,16+,18?,19?/m1/s1 |
| InChIKey | YGOFTVYVJMAMJA-RTRYZKMWSA-N |
| XLogP | 3.82 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |