C13H19Cl2N3O4S — CID 120710284
N-[1-(aminomethyl)cyclopentyl]-2-chloro-5-methyl-3-nitrobenzenesulfonamide;hydrochloride (PubChem CID 120710284) has the molecular formula C13H19Cl2N3O4S and a molecular weight of 384.29 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclopentyl]-2-chloro-5-methyl-3-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-[1-(aminomethyl)cyclopentyl]-2-chloro-5-methyl-3-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120710284 |
| Molecular Formula | C13H19Cl2N3O4S |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | N-[1-(aminomethyl)cyclopentyl]-2-chloro-5-methyl-3-nitrobenzenesulfonamide;hydrochloride |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)c(S(=O)(=O)NC2(CN)CCCC2)c1.Cl |
| InChI | InChI=1S/C13H18ClN3O4S.ClH/c1-9-6-10(17(18)19)12(14)11(7-9)22(20,21)16-13(8-15)4-2-3-5-13;/h6-7,16H,2-5,8,15H2,1H3;1H |
| InChIKey | HAMSDCPPKZOKNQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|