C7H7ClN2O4S — CID 63839177
2-chloro-5-methyl-3-nitrobenzenesulfonamide (PubChem CID 63839177) has the molecular formula C7H7ClN2O4S and a molecular weight of 250.66 g/mol. Its IUPAC name is 2-chloro-5-methyl-3-nitrobenzenesulfonamide.
| Compound Name | 2-chloro-5-methyl-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 63839177 |
| Molecular Formula | C7H7ClN2O4S |
| Molecular Weight | 250.66 g/mol |
| Exact Mass | 249.98 |
| IUPAC Name | 2-chloro-5-methyl-3-nitrobenzenesulfonamide |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)c(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C7H7ClN2O4S/c1-4-2-5(10(11)12)7(8)6(3-4)15(9,13)14/h2-3H,1H3,(H2,9,13,14) |
| InChIKey | PQMDQFNDBAAYBJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 103.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.66 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|