C11H17Cl2N3O4S — CID 120710634
N-(1-aminopropan-2-yl)-2-chloro-N,5-dimethyl-3-nitrobenzenesulfonamide;hydrochloride (PubChem CID 120710634) has the molecular formula C11H17Cl2N3O4S and a molecular weight of 358.25 g/mol. Its IUPAC name is N-(1-aminopropan-2-yl)-2-chloro-N,5-dimethyl-3-nitrobenzenesulfonamide;hydrochloride.
| Compound Name | N-(1-aminopropan-2-yl)-2-chloro-N,5-dimethyl-3-nitrobenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120710634 |
| Molecular Formula | C11H17Cl2N3O4S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | N-(1-aminopropan-2-yl)-2-chloro-N,5-dimethyl-3-nitrobenzenesulfonamide;hydrochloride |
| SMILES | Cc1cc([N+](=O)[O-])c(Cl)c(S(=O)(=O)N(C)C(C)CN)c1.Cl |
| InChI | InChI=1S/C11H16ClN3O4S.ClH/c1-7-4-9(15(16)17)11(12)10(5-7)20(18,19)14(3)8(2)6-13;/h4-5,8H,6,13H2,1-3H3;1H |
| InChIKey | DNJKNYONWKOMJQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|