C14H17F3N2O2S — CID 120712698
N-(8-azabicyclo[3.2.1]octan-3-yl)-2,3,4-trifluoro-N-methylbenzenesulfonamide (PubChem CID 120712698) has the molecular formula C14H17F3N2O2S and a molecular weight of 334.36 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-2,3,4-trifluoro-N-methylbenzenesulfonamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2,3,4-trifluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 120712698 |
| Molecular Formula | C14H17F3N2O2S |
| Molecular Weight | 334.36 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-2,3,4-trifluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CC2CCC(C1)N2)S(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H17F3N2O2S/c1-19(10-6-8-2-3-9(7-10)18-8)22(20,21)12-5-4-11(15)13(16)14(12)17/h4-5,8-10,18H,2-3,6-7H2,1H3 |
| InChIKey | YWWDNRNOCINIEV-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.36 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|