C14H18ClFN2O2S — CID 120894149
N-(8-azabicyclo[3.2.1]octan-3-yl)-5-chloro-2-fluoro-N-methylbenzenesulfonamide (PubChem CID 120894149) has the molecular formula C14H18ClFN2O2S and a molecular weight of 332.83 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-5-chloro-2-fluoro-N-methylbenzenesulfonamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-5-chloro-2-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 120894149 |
| Molecular Formula | C14H18ClFN2O2S |
| Molecular Weight | 332.83 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-5-chloro-2-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN(C1CC2CCC(C1)N2)S(=O)(=O)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C14H18ClFN2O2S/c1-18(12-7-10-3-4-11(8-12)17-10)21(19,20)14-6-9(15)2-5-13(14)16/h2,5-6,10-12,17H,3-4,7-8H2,1H3 |
| InChIKey | VMUYIDBBXBAZME-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.83 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |