C17H23ClN2O2S — CID 120715784
N-[2-(4-aminophenyl)ethyl]-3-propan-2-ylbenzenesulfonamide;hydrochloride (PubChem CID 120715784) has the molecular formula C17H23ClN2O2S and a molecular weight of 354.90 g/mol. Its IUPAC name is N-[2-(4-aminophenyl)ethyl]-3-propan-2-ylbenzenesulfonamide;hydrochloride.
| Compound Name | N-[2-(4-aminophenyl)ethyl]-3-propan-2-ylbenzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120715784 |
| Molecular Formula | C17H23ClN2O2S |
| Molecular Weight | 354.90 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | N-[2-(4-aminophenyl)ethyl]-3-propan-2-ylbenzenesulfonamide;hydrochloride |
| SMILES | CC(C)c1cccc(S(=O)(=O)NCCc2ccc(N)cc2)c1.Cl |
| InChI | InChI=1S/C17H22N2O2S.ClH/c1-13(2)15-4-3-5-17(12-15)22(20,21)19-11-10-14-6-8-16(18)9-7-14;/h3-9,12-13,19H,10-11,18H2,1-2H3;1H |
| InChIKey | XADMBOXAGKPKMU-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.90 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|