C17H22ClN3O4S2 — CID 120715618
1-N-[2-(4-aminophenyl)ethyl]-3-N-cyclopropylbenzene-1,3-disulfonamide;hydrochloride (PubChem CID 120715618) has the molecular formula C17H22ClN3O4S2 and a molecular weight of 431.97 g/mol. Its IUPAC name is 1-N-[2-(4-aminophenyl)ethyl]-3-N-cyclopropylbenzene-1,3-disulfonamide;hydrochloride.
| Compound Name | 1-N-[2-(4-aminophenyl)ethyl]-3-N-cyclopropylbenzene-1,3-disulfonamide;hydrochloride |
|---|---|
| PubChem CID | 120715618 |
| Molecular Formula | C17H22ClN3O4S2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | 1-N-[2-(4-aminophenyl)ethyl]-3-N-cyclopropylbenzene-1,3-disulfonamide;hydrochloride |
| SMILES | Cl.Nc1ccc(CCNS(=O)(=O)c2cccc(S(=O)(=O)NC3CC3)c2)cc1 |
| InChI | InChI=1S/C17H21N3O4S2.ClH/c18-14-6-4-13(5-7-14)10-11-19-25(21,22)16-2-1-3-17(12-16)26(23,24)20-15-8-9-15;/h1-7,12,15,19-20H,8-11,18H2;1H |
| InChIKey | DRLBZRINHVNCCE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|