C12H13BrClFN2O2S — CID 120721700
2-bromo-6-chloro-4-fluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide (PubChem CID 120721700) has the molecular formula C12H13BrClFN2O2S and a molecular weight of 383.67 g/mol. Its IUPAC name is 2-bromo-6-chloro-4-fluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide.
| Compound Name | 2-bromo-6-chloro-4-fluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 120721700 |
| Molecular Formula | C12H13BrClFN2O2S |
| Molecular Weight | 383.67 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | 2-bromo-6-chloro-4-fluoro-N-(1,2,3,6-tetrahydropyridin-4-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1=CCNCC1)c1c(Cl)cc(F)cc1Br |
| InChI | InChI=1S/C12H13BrClFN2O2S/c13-10-5-9(15)6-11(14)12(10)20(18,19)17-7-8-1-3-16-4-2-8/h1,5-6,16-17H,2-4,7H2 |
| InChIKey | UXOKJANZZPWPNJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.67 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|