C16H22ClN3O2S — CID 120725603
8-(2,3-dimethylpiperazin-1-yl)sulfonyl-3-methylquinoline;hydrochloride (PubChem CID 120725603) has the molecular formula C16H22ClN3O2S and a molecular weight of 355.89 g/mol. Its IUPAC name is 8-(2,3-dimethylpiperazin-1-yl)sulfonyl-3-methylquinoline;hydrochloride.
| Compound Name | 8-(2,3-dimethylpiperazin-1-yl)sulfonyl-3-methylquinoline;hydrochloride |
|---|---|
| PubChem CID | 120725603 |
| Molecular Formula | C16H22ClN3O2S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 8-(2,3-dimethylpiperazin-1-yl)sulfonyl-3-methylquinoline;hydrochloride |
| SMILES | Cc1cnc2c(S(=O)(=O)N3CCNC(C)C3C)cccc2c1.Cl |
| InChI | InChI=1S/C16H21N3O2S.ClH/c1-11-9-14-5-4-6-15(16(14)18-10-11)22(20,21)19-8-7-17-12(2)13(19)3;/h4-6,9-10,12-13,17H,7-8H2,1-3H3;1H |
| InChIKey | MSMQCRRTDAOJKE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |