C21H27FN6O — CID 120728101
1-cyclopentyl-2-[[(2R,3S)-2-[1-(4-fluorophenyl)pyrazol-4-yl]-1-methyl-5-oxopyrrolidin-3-yl]methyl]guanidine (PubChem CID 120728101) has the molecular formula C21H27FN6O and a molecular weight of 398.49 g/mol. Its IUPAC name is 1-cyclopentyl-2-[[(2R,3S)-2-[1-(4-fluorophenyl)pyrazol-4-yl]-1-methyl-5-oxopyrrolidin-3-yl]methyl]guanidine.
| Compound Name | 1-cyclopentyl-2-[[(2R,3S)-2-[1-(4-fluorophenyl)pyrazol-4-yl]-1-methyl-5-oxopyrrolidin-3-yl]methyl]guanidine |
|---|---|
| PubChem CID | 120728101 |
| Molecular Formula | C21H27FN6O |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 1-cyclopentyl-2-[[(2R,3S)-2-[1-(4-fluorophenyl)pyrazol-4-yl]-1-methyl-5-oxopyrrolidin-3-yl]methyl]guanidine |
| SMILES | CN1C(=O)C[C@@H](C/N=C(\N)NC2CCCC2)[C@@H]1c1cnn(-c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H27FN6O/c1-27-19(29)10-14(11-24-21(23)26-17-4-2-3-5-17)20(27)15-12-25-28(13-15)18-8-6-16(22)7-9-18/h6-9,12-14,17,20H,2-5,10-11H2,1H3,(H3,23,24,26)/t14-,20+/m0/s1 |
| InChIKey | HDOWEZABCSNYAL-VBKZILBWSA-N |
| XLogP | 2.38 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|