C20H22Cl2N4O2 — CID 120729855
(6-methoxyquinolin-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 120729855) has the molecular formula C20H22Cl2N4O2 and a molecular weight of 421.33 g/mol. Its IUPAC name is (6-methoxyquinolin-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | (6-methoxyquinolin-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 120729855 |
| Molecular Formula | C20H22Cl2N4O2 |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | (6-methoxyquinolin-2-yl)-(2-pyridin-3-ylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | COc1ccc2nc(C(=O)N3CCNCC3c3cccnc3)ccc2c1.Cl.Cl |
| InChI | InChI=1S/C20H20N4O2.2ClH/c1-26-16-5-7-17-14(11-16)4-6-18(23-17)20(25)24-10-9-22-13-19(24)15-3-2-8-21-12-15;;/h2-8,11-12,19,22H,9-10,13H2,1H3;2*1H |
| InChIKey | XHVUVYQDURDZGA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |