C17H21ClN4O2 — CID 120732596
1-[1-methyl-5-(2-pyridin-3-ylpiperazine-1-carbonyl)pyrrol-3-yl]ethanone;hydrochloride (PubChem CID 120732596) has the molecular formula C17H21ClN4O2 and a molecular weight of 348.83 g/mol. Its IUPAC name is 1-[1-methyl-5-(2-pyridin-3-ylpiperazine-1-carbonyl)pyrrol-3-yl]ethanone;hydrochloride.
| Compound Name | 1-[1-methyl-5-(2-pyridin-3-ylpiperazine-1-carbonyl)pyrrol-3-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 120732596 |
| Molecular Formula | C17H21ClN4O2 |
| Molecular Weight | 348.83 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 1-[1-methyl-5-(2-pyridin-3-ylpiperazine-1-carbonyl)pyrrol-3-yl]ethanone;hydrochloride |
| SMILES | CC(=O)c1cc(C(=O)N2CCNCC2c2cccnc2)n(C)c1.Cl |
| InChI | InChI=1S/C17H20N4O2.ClH/c1-12(22)14-8-15(20(2)11-14)17(23)21-7-6-19-10-16(21)13-4-3-5-18-9-13;/h3-5,8-9,11,16,19H,6-7,10H2,1-2H3;1H |
| InChIKey | IQMVROLDMHVNIX-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.83 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |