C19H21ClN4O2 — CID 120733966
1H-indazol-4-yl-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 120733966) has the molecular formula C19H21ClN4O2 and a molecular weight of 372.86 g/mol. Its IUPAC name is 1H-indazol-4-yl-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;hydrochloride.
| Compound Name | 1H-indazol-4-yl-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 120733966 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1H-indazol-4-yl-[2-(2-methoxyphenyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | COc1ccccc1C1CNCCN1C(=O)c1cccc2[nH]ncc12.Cl |
| InChI | InChI=1S/C19H20N4O2.ClH/c1-25-18-8-3-2-5-14(18)17-12-20-9-10-23(17)19(24)13-6-4-7-16-15(13)11-21-22-16;/h2-8,11,17,20H,9-10,12H2,1H3,(H,21,22);1H |
| InChIKey | CQKBUJDYEIZUBJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |