C19H21ClFN3O2 — CID 120735479
2-(5-chloro-2-methoxyanilino)-1-[2-(3-fluorophenyl)piperazin-1-yl]ethanone (PubChem CID 120735479) has the molecular formula C19H21ClFN3O2 and a molecular weight of 377.85 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyanilino)-1-[2-(3-fluorophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(5-chloro-2-methoxyanilino)-1-[2-(3-fluorophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 120735479 |
| Molecular Formula | C19H21ClFN3O2 |
| Molecular Weight | 377.85 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-(5-chloro-2-methoxyanilino)-1-[2-(3-fluorophenyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccc(Cl)cc1NCC(=O)N1CCNCC1c1cccc(F)c1 |
| InChI | InChI=1S/C19H21ClFN3O2/c1-26-18-6-5-14(20)10-16(18)23-12-19(25)24-8-7-22-11-17(24)13-3-2-4-15(21)9-13/h2-6,9-10,17,22-23H,7-8,11-12H2,1H3 |
| InChIKey | CBFNBXXSBPPJDR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.85 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |