C20H24ClFN2O2 — CID 120737341
1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(2-methoxy-5-methylphenyl)ethanone;hydrochloride (PubChem CID 120737341) has the molecular formula C20H24ClFN2O2 and a molecular weight of 378.88 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(2-methoxy-5-methylphenyl)ethanone;hydrochloride.
| Compound Name | 1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(2-methoxy-5-methylphenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 120737341 |
| Molecular Formula | C20H24ClFN2O2 |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 1-[2-(3-fluorophenyl)piperazin-1-yl]-2-(2-methoxy-5-methylphenyl)ethanone;hydrochloride |
| SMILES | COc1ccc(C)cc1CC(=O)N1CCNCC1c1cccc(F)c1.Cl |
| InChI | InChI=1S/C20H23FN2O2.ClH/c1-14-6-7-19(25-2)16(10-14)12-20(24)23-9-8-22-13-18(23)15-4-3-5-17(21)11-15;/h3-7,10-11,18,22H,8-9,12-13H2,1-2H3;1H |
| InChIKey | CSGGVQZBDQGGTF-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |